C19H22N2O3S — CID 7773883
[2-(2-methylpropylamino)-2-oxoethyl] 2-(4-methylphenyl)sulfanylpyridine-3-carboxylate (PubChem CID 7773883) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is [2-(2-methylpropylamino)-2-oxoethyl] 2-(4-methylphenyl)sulfanylpyridine-3-carboxylate.
| Compound Name | [2-(2-methylpropylamino)-2-oxoethyl] 2-(4-methylphenyl)sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 7773883 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [2-(2-methylpropylamino)-2-oxoethyl] 2-(4-methylphenyl)sulfanylpyridine-3-carboxylate |
| SMILES | Cc1ccc(Sc2ncccc2C(=O)OCC(=O)NCC(C)C)cc1 |
| InChI | InChI=1S/C19H22N2O3S/c1-13(2)11-21-17(22)12-24-19(23)16-5-4-10-20-18(16)25-15-8-6-14(3)7-9-15/h4-10,13H,11-12H2,1-3H3,(H,21,22) |
| InChIKey | UOZGTQBPBNXDJN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |