C18H20N2O3S — CID 7773891
[2-oxo-2-(propylamino)ethyl] 2-(4-methylphenyl)sulfanylpyridine-3-carboxylate (PubChem CID 7773891) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is [2-oxo-2-(propylamino)ethyl] 2-(4-methylphenyl)sulfanylpyridine-3-carboxylate.
| Compound Name | [2-oxo-2-(propylamino)ethyl] 2-(4-methylphenyl)sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 7773891 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [2-oxo-2-(propylamino)ethyl] 2-(4-methylphenyl)sulfanylpyridine-3-carboxylate |
| SMILES | CCCNC(=O)COC(=O)c1cccnc1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C18H20N2O3S/c1-3-10-19-16(21)12-23-18(22)15-5-4-11-20-17(15)24-14-8-6-13(2)7-9-14/h4-9,11H,3,10,12H2,1-2H3,(H,19,21) |
| InChIKey | KCNMRAUIBYGBNL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |