C18H18ClN3O4S — CID 7773784
[2-oxo-2-(propylcarbamoylamino)ethyl] 2-(2-chlorophenyl)sulfanylpyridine-3-carboxylate (PubChem CID 7773784) has the molecular formula C18H18ClN3O4S and a molecular weight of 407.88 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] 2-(2-chlorophenyl)sulfanylpyridine-3-carboxylate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 2-(2-chlorophenyl)sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 7773784 |
| Molecular Formula | C18H18ClN3O4S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 2-(2-chlorophenyl)sulfanylpyridine-3-carboxylate |
| SMILES | CCCNC(=O)NC(=O)COC(=O)c1cccnc1Sc1ccccc1Cl |
| InChI | InChI=1S/C18H18ClN3O4S/c1-2-9-21-18(25)22-15(23)11-26-17(24)12-6-5-10-20-16(12)27-14-8-4-3-7-13(14)19/h3-8,10H,2,9,11H2,1H3,(H2,21,22,23,25) |
| InChIKey | QQENXJFYRMIRCD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |