C18H19ClN2O3S — CID 8741084
[(2R)-1-oxo-1-(propylamino)propan-2-yl] 2-(2-chlorophenyl)sulfanylpyridine-3-carboxylate (PubChem CID 8741084) has the molecular formula C18H19ClN2O3S and a molecular weight of 378.88 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(propylamino)propan-2-yl] 2-(2-chlorophenyl)sulfanylpyridine-3-carboxylate.
| Compound Name | [(2R)-1-oxo-1-(propylamino)propan-2-yl] 2-(2-chlorophenyl)sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 8741084 |
| Molecular Formula | C18H19ClN2O3S |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | [(2R)-1-oxo-1-(propylamino)propan-2-yl] 2-(2-chlorophenyl)sulfanylpyridine-3-carboxylate |
| SMILES | CCCNC(=O)[C@@H](C)OC(=O)c1cccnc1Sc1ccccc1Cl |
| InChI | InChI=1S/C18H19ClN2O3S/c1-3-10-20-16(22)12(2)24-18(23)13-7-6-11-21-17(13)25-15-9-5-4-8-14(15)19/h4-9,11-12H,3,10H2,1-2H3,(H,20,22)/t12-/m1/s1 |
| InChIKey | FYSWTRUVMOQQDZ-GFCCVEGCSA-N |
| XLogP | 3.96 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |