C14H11ClN2O3S — CID 7773797
(2-amino-2-oxoethyl) 2-(2-chlorophenyl)sulfanylpyridine-3-carboxylate (PubChem CID 7773797) has the molecular formula C14H11ClN2O3S and a molecular weight of 322.77 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-(2-chlorophenyl)sulfanylpyridine-3-carboxylate.
| Compound Name | (2-amino-2-oxoethyl) 2-(2-chlorophenyl)sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 7773797 |
| Molecular Formula | C14H11ClN2O3S |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-(2-chlorophenyl)sulfanylpyridine-3-carboxylate |
| SMILES | NC(=O)COC(=O)c1cccnc1Sc1ccccc1Cl |
| InChI | InChI=1S/C14H11ClN2O3S/c15-10-5-1-2-6-11(10)21-13-9(4-3-7-17-13)14(19)20-8-12(16)18/h1-7H,8H2,(H2,16,18) |
| InChIKey | UXHYZEPDXQIYSY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |