C26H30N2O6S — CID 25321554
ethyl (1S,3R,3aS,6aS)-1-(4-hydroxy-3-methoxyphenyl)-5-(4-methylphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 25321554) has the molecular formula C26H30N2O6S and a molecular weight of 498.60 g/mol. Its IUPAC name is ethyl (1S,3R,3aS,6aS)-1-(4-hydroxy-3-methoxyphenyl)-5-(4-methylphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | ethyl (1S,3R,3aS,6aS)-1-(4-hydroxy-3-methoxyphenyl)-5-(4-methylphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 25321554 |
| Molecular Formula | C26H30N2O6S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | ethyl (1S,3R,3aS,6aS)-1-(4-hydroxy-3-methoxyphenyl)-5-(4-methylphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(CCSC)N[C@H](c2ccc(O)c(OC)c2)[C@H]2C(=O)N(c3ccc(C)cc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C26H30N2O6S/c1-5-34-25(32)26(12-13-35-4)21-20(22(27-26)16-8-11-18(29)19(14-16)33-3)23(30)28(24(21)31)17-9-6-15(2)7-10-17/h6-11,14,20-22,27,29H,5,12-13H2,1-4H3/t20-,21+,22+,26+/m0/s1 |
| InChIKey | JCCVQMCIMQAQJV-AVJFOWIRSA-N |
| XLogP | 3.21 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|