C21H25N5O3S2 — CID 25328720
2-[(4-benzylsulfonylpiperazin-1-yl)methyl]-4-(2-methoxyphenyl)-1,2,4-triazole-3-thione (PubChem CID 25328720) has the molecular formula C21H25N5O3S2 and a molecular weight of 459.60 g/mol. Its IUPAC name is 2-[(4-benzylsulfonylpiperazin-1-yl)methyl]-4-(2-methoxyphenyl)-1,2,4-triazole-3-thione.
| Compound Name | 2-[(4-benzylsulfonylpiperazin-1-yl)methyl]-4-(2-methoxyphenyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 25328720 |
| Molecular Formula | C21H25N5O3S2 |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 2-[(4-benzylsulfonylpiperazin-1-yl)methyl]-4-(2-methoxyphenyl)-1,2,4-triazole-3-thione |
| SMILES | COc1ccccc1-n1cnn(CN2CCN(S(=O)(=O)Cc3ccccc3)CC2)c1=S |
| InChI | InChI=1S/C21H25N5O3S2/c1-29-20-10-6-5-9-19(20)25-16-22-26(21(25)30)17-23-11-13-24(14-12-23)31(27,28)15-18-7-3-2-4-8-18/h2-10,16H,11-15,17H2,1H3 |
| InChIKey | KRDVTYNBAQLRKS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 72.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|