C23H31N3O3S — CID 42291255
1-[(3R)-1-benzylsulfonylpiperidin-3-yl]-4-(2-methoxyphenyl)piperazine (PubChem CID 42291255) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is 1-[(3R)-1-benzylsulfonylpiperidin-3-yl]-4-(2-methoxyphenyl)piperazine.
| Compound Name | 1-[(3R)-1-benzylsulfonylpiperidin-3-yl]-4-(2-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 42291255 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 1-[(3R)-1-benzylsulfonylpiperidin-3-yl]-4-(2-methoxyphenyl)piperazine |
| SMILES | COc1ccccc1N1CCN([C@@H]2CCCN(S(=O)(=O)Cc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C23H31N3O3S/c1-29-23-12-6-5-11-22(23)25-16-14-24(15-17-25)21-10-7-13-26(18-21)30(27,28)19-20-8-3-2-4-9-20/h2-6,8-9,11-12,21H,7,10,13-19H2,1H3/t21-/m1/s1 |
| InChIKey | MXTPXFDSYVGLMR-OAQYLSRUSA-N |
| XLogP | 2.81 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |