C18H20N4O2S2 — CID 25329123
6-[2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 25329123) has the molecular formula C18H20N4O2S2 and a molecular weight of 388.52 g/mol. Its IUPAC name is 6-[2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 6-[2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 25329123 |
| Molecular Formula | C18H20N4O2S2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 6-[2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | C=CCn1c(=S)sc2c(=O)n(CC(=O)c3cc(C)n(CC)c3C)cnc21 |
| InChI | InChI=1S/C18H20N4O2S2/c1-5-7-22-16-15(26-18(22)25)17(24)20(10-19-16)9-14(23)13-8-11(3)21(6-2)12(13)4/h5,8,10H,1,6-7,9H2,2-4H3 |
| InChIKey | VVIIGASVTLBGQB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|