C18H16Cl2N4O2S2 — CID 74441984
N-[1-(3,4-dichlorophenyl)ethyl]-2-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)acetamide (PubChem CID 74441984) has the molecular formula C18H16Cl2N4O2S2 and a molecular weight of 455.39 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)ethyl]-2-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)acetamide.
| Compound Name | N-[1-(3,4-dichlorophenyl)ethyl]-2-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)acetamide |
|---|---|
| PubChem CID | 74441984 |
| Molecular Formula | C18H16Cl2N4O2S2 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)ethyl]-2-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)acetamide |
| SMILES | C=CCn1c(=S)sc2c(=O)n(CC(=O)NC(C)c3ccc(Cl)c(Cl)c3)cnc21 |
| InChI | InChI=1S/C18H16Cl2N4O2S2/c1-3-6-24-16-15(28-18(24)27)17(26)23(9-21-16)8-14(25)22-10(2)11-4-5-12(19)13(20)7-11/h3-5,7,9-10H,1,6,8H2,2H3,(H,22,25) |
| InChIKey | ARHAJMMLUKQVMR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|