C18H17ClN4O2S2 — CID 52546891
N-[(2-chlorophenyl)methyl]-3-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)propanamide (PubChem CID 52546891) has the molecular formula C18H17ClN4O2S2 and a molecular weight of 420.95 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-3-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)propanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-3-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)propanamide |
|---|---|
| PubChem CID | 52546891 |
| Molecular Formula | C18H17ClN4O2S2 |
| Molecular Weight | 420.95 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-3-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)propanamide |
| SMILES | C=CCn1c(=S)sc2c(=O)n(CCC(=O)NCc3ccccc3Cl)cnc21 |
| InChI | InChI=1S/C18H17ClN4O2S2/c1-2-8-23-16-15(27-18(23)26)17(25)22(11-21-16)9-7-14(24)20-10-12-5-3-4-6-13(12)19/h2-6,11H,1,7-10H2,(H,20,24) |
| InChIKey | YNCQADXCFFJYJS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.95 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|