C22H18N4O2S3 — CID 25327503
2-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)-N-(2-phenylsulfanylphenyl)acetamide (PubChem CID 25327503) has the molecular formula C22H18N4O2S3 and a molecular weight of 466.61 g/mol. Its IUPAC name is 2-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)-N-(2-phenylsulfanylphenyl)acetamide.
| Compound Name | 2-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)-N-(2-phenylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 25327503 |
| Molecular Formula | C22H18N4O2S3 |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | 2-(7-oxo-3-prop-2-enyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)-N-(2-phenylsulfanylphenyl)acetamide |
| SMILES | C=CCn1c(=S)sc2c(=O)n(CC(=O)Nc3ccccc3Sc3ccccc3)cnc21 |
| InChI | InChI=1S/C22H18N4O2S3/c1-2-12-26-20-19(31-22(26)29)21(28)25(14-23-20)13-18(27)24-16-10-6-7-11-17(16)30-15-8-4-3-5-9-15/h2-11,14H,1,12-13H2,(H,24,27) |
| InChIKey | HZFGQXBLGKLWMO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|