C14H15N5O2S2 — CID 36814773
3-prop-2-enyl-6-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 36814773) has the molecular formula C14H15N5O2S2 and a molecular weight of 349.44 g/mol. Its IUPAC name is 3-prop-2-enyl-6-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 3-prop-2-enyl-6-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 36814773 |
| Molecular Formula | C14H15N5O2S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 3-prop-2-enyl-6-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | C=CCn1c(=S)sc2c(=O)n(Cc3nc(CCC)no3)cnc21 |
| InChI | InChI=1S/C14H15N5O2S2/c1-3-5-9-16-10(21-17-9)7-18-8-15-12-11(13(18)20)23-14(22)19(12)6-4-2/h4,8H,2-3,5-7H2,1H3 |
| InChIKey | KRHLKHMSWUQUPC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|