C20H23N3O3 — CID 25329518
(2S)-N-(cyclopropylcarbamoyl)-2-(4-phenylmethoxyanilino)propanamide (PubChem CID 25329518) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is (2S)-N-(cyclopropylcarbamoyl)-2-(4-phenylmethoxyanilino)propanamide.
| Compound Name | (2S)-N-(cyclopropylcarbamoyl)-2-(4-phenylmethoxyanilino)propanamide |
|---|---|
| PubChem CID | 25329518 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (2S)-N-(cyclopropylcarbamoyl)-2-(4-phenylmethoxyanilino)propanamide |
| SMILES | C[C@H](Nc1ccc(OCc2ccccc2)cc1)C(=O)NC(=O)NC1CC1 |
| InChI | InChI=1S/C20H23N3O3/c1-14(19(24)23-20(25)22-17-7-8-17)21-16-9-11-18(12-10-16)26-13-15-5-3-2-4-6-15/h2-6,9-12,14,17,21H,7-8,13H2,1H3,(H2,22,23,24,25)/t14-/m0/s1 |
| InChIKey | UAQZMBRCDSQXLA-AWEZNQCLSA-N |
| XLogP | 3.05 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|