C18H16F2N4OS — CID 25330180
3-[[[1-(difluoromethyl)benzimidazol-2-yl]methyl-methylamino]methyl]-1,3-benzoxazole-2-thione (PubChem CID 25330180) has the molecular formula C18H16F2N4OS and a molecular weight of 374.42 g/mol. Its IUPAC name is 3-[[[1-(difluoromethyl)benzimidazol-2-yl]methyl-methylamino]methyl]-1,3-benzoxazole-2-thione.
| Compound Name | 3-[[[1-(difluoromethyl)benzimidazol-2-yl]methyl-methylamino]methyl]-1,3-benzoxazole-2-thione |
|---|---|
| PubChem CID | 25330180 |
| Molecular Formula | C18H16F2N4OS |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 3-[[[1-(difluoromethyl)benzimidazol-2-yl]methyl-methylamino]methyl]-1,3-benzoxazole-2-thione |
| SMILES | CN(Cc1nc2ccccc2n1C(F)F)Cn1c(=S)oc2ccccc21 |
| InChI | InChI=1S/C18H16F2N4OS/c1-22(11-23-14-8-4-5-9-15(14)25-18(23)26)10-16-21-12-6-2-3-7-13(12)24(16)17(19)20/h2-9,17H,10-11H2,1H3 |
| InChIKey | NTRJKJOUYAKVAJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 39.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|