C19H19F2N3O2 — CID 39975772
N-[[1-(difluoromethyl)benzimidazol-2-yl]methyl]-2-ethoxy-N-methylbenzamide (PubChem CID 39975772) has the molecular formula C19H19F2N3O2 and a molecular weight of 359.38 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)benzimidazol-2-yl]methyl]-2-ethoxy-N-methylbenzamide.
| Compound Name | N-[[1-(difluoromethyl)benzimidazol-2-yl]methyl]-2-ethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 39975772 |
| Molecular Formula | C19H19F2N3O2 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N-[[1-(difluoromethyl)benzimidazol-2-yl]methyl]-2-ethoxy-N-methylbenzamide |
| SMILES | CCOc1ccccc1C(=O)N(C)Cc1nc2ccccc2n1C(F)F |
| InChI | InChI=1S/C19H19F2N3O2/c1-3-26-16-11-7-4-8-13(16)18(25)23(2)12-17-22-14-9-5-6-10-15(14)24(17)19(20)21/h4-11,19H,3,12H2,1-2H3 |
| InChIKey | SMYCPLGNRZNNMM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |