C16H14FN3OS — CID 25330536
5-(4-fluorophenyl)-N-[(1S)-1-thiophen-2-ylethyl]-1H-pyrazole-4-carboxamide (PubChem CID 25330536) has the molecular formula C16H14FN3OS and a molecular weight of 315.37 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[(1S)-1-thiophen-2-ylethyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-[(1S)-1-thiophen-2-ylethyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 25330536 |
| Molecular Formula | C16H14FN3OS |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[(1S)-1-thiophen-2-ylethyl]-1H-pyrazole-4-carboxamide |
| SMILES | C[C@H](NC(=O)c1cn[nH]c1-c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C16H14FN3OS/c1-10(14-3-2-8-22-14)19-16(21)13-9-18-20-15(13)11-4-6-12(17)7-5-11/h2-10H,1H3,(H,18,20)(H,19,21)/t10-/m0/s1 |
| InChIKey | QIEYKWHPSIMUSJ-JTQLQIEISA-N |
| XLogP | 3.77 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |