C20H21FN4OS — CID 24640449
5-(4-fluorophenyl)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-1H-pyrazole-4-carboxamide (PubChem CID 24640449) has the molecular formula C20H21FN4OS and a molecular weight of 384.48 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 24640449 |
| Molecular Formula | C20H21FN4OS |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NCC(c1cccs1)N1CCCC1)c1cn[nH]c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FN4OS/c21-15-7-5-14(6-8-15)19-16(12-23-24-19)20(26)22-13-17(18-4-3-11-27-18)25-9-1-2-10-25/h3-8,11-12,17H,1-2,9-10,13H2,(H,22,26)(H,23,24) |
| InChIKey | AOQQYFRHPOROJW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |