C22H26N4O2S — CID 25330826
3-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]propanamide (PubChem CID 25330826) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is 3-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]propanamide.
| Compound Name | 3-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 25330826 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 3-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]propanamide |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=O)CCSCc2cn3ccccc3n2)c(C)c1 |
| InChI | InChI=1S/C22H26N4O2S/c1-15-10-16(2)22(17(3)11-15)25-21(28)12-23-20(27)7-9-29-14-18-13-26-8-5-4-6-19(26)24-18/h4-6,8,10-11,13H,7,9,12,14H2,1-3H3,(H,23,27)(H,25,28) |
| InChIKey | UISGKDPUGZWVHZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|