C22H20BrN3O2S — CID 25405951
N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)propanamide (PubChem CID 25405951) has the molecular formula C22H20BrN3O2S and a molecular weight of 470.39 g/mol. Its IUPAC name is N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)propanamide.
| Compound Name | N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)propanamide |
|---|---|
| PubChem CID | 25405951 |
| Molecular Formula | C22H20BrN3O2S |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)propanamide |
| SMILES | O=C(CCSCc1cn2ccccc2n1)NCc1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C22H20BrN3O2S/c23-17-6-4-16(5-7-17)20-9-8-19(28-20)13-24-22(27)10-12-29-15-18-14-26-11-2-1-3-21(26)25-18/h1-9,11,14H,10,12-13,15H2,(H,24,27) |
| InChIKey | DBYTWFZPAMZCSC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 59.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|