C16H18N4O3S — CID 95345703
[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] 3-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)propanoate (PubChem CID 95345703) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is [(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] 3-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)propanoate.
| Compound Name | [(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] 3-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)propanoate |
|---|---|
| PubChem CID | 95345703 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | [(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] 3-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)propanoate |
| SMILES | Cc1noc([C@H](C)OC(=O)CCSCc2cn3ccccc3n2)n1 |
| InChI | InChI=1S/C16H18N4O3S/c1-11(16-17-12(2)19-23-16)22-15(21)6-8-24-10-13-9-20-7-4-3-5-14(20)18-13/h3-5,7,9,11H,6,8,10H2,1-2H3/t11-/m0/s1 |
| InChIKey | DCCAPUBQGPYDHF-NSHDSACASA-N |
| XLogP | 2.95 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|