C30H38N3P — CID 25334056
tert-butyl-(3,4-dimethylphenyl)imino-(9-ethylcarbazol-3-yl)-pyrrolidin-1-yl-λ5-phosphane (PubChem CID 25334056) has the molecular formula C30H38N3P and a molecular weight of 471.63 g/mol. Its IUPAC name is tert-butyl-(3,4-dimethylphenyl)imino-(9-ethylcarbazol-3-yl)-pyrrolidin-1-yl-λ5-phosphane.
| Compound Name | tert-butyl-(3,4-dimethylphenyl)imino-(9-ethylcarbazol-3-yl)-pyrrolidin-1-yl-λ5-phosphane |
|---|---|
| PubChem CID | 25334056 |
| Molecular Formula | C30H38N3P |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | tert-butyl-(3,4-dimethylphenyl)imino-(9-ethylcarbazol-3-yl)-pyrrolidin-1-yl-λ5-phosphane |
| SMILES | CCn1c2ccccc2c2cc([P@@](=Nc3ccc(C)c(C)c3)(N3CCCC3)C(C)(C)C)ccc21 |
| InChI | InChI=1S/C30H38N3P/c1-7-33-28-13-9-8-12-26(28)27-21-25(16-17-29(27)33)34(30(4,5)6,32-18-10-11-19-32)31-24-15-14-22(2)23(3)20-24/h8-9,12-17,20-21H,7,10-11,18-19H2,1-6H3/t34-/m1/s1 |
| InChIKey | VIBRVORBDPUEHD-UUWRZZSWSA-N |
| XLogP | 8.40 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|