C29H35N4O2P — CID 5187692
tert-butyl-(9-ethylcarbazol-3-yl)-(2-methyl-5-nitrophenyl)imino-pyrrolidin-1-yl-λ5-phosphane (PubChem CID 5187692) has the molecular formula C29H35N4O2P and a molecular weight of 502.60 g/mol. Its IUPAC name is tert-butyl-(9-ethylcarbazol-3-yl)-(2-methyl-5-nitrophenyl)imino-pyrrolidin-1-yl-λ5-phosphane.
| Compound Name | tert-butyl-(9-ethylcarbazol-3-yl)-(2-methyl-5-nitrophenyl)imino-pyrrolidin-1-yl-λ5-phosphane |
|---|---|
| PubChem CID | 5187692 |
| Molecular Formula | C29H35N4O2P |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | tert-butyl-(9-ethylcarbazol-3-yl)-(2-methyl-5-nitrophenyl)imino-pyrrolidin-1-yl-λ5-phosphane |
| SMILES | CCn1c2ccccc2c2cc(P(=Nc3cc([N+](=O)[O-])ccc3C)(N3CCCC3)C(C)(C)C)ccc21 |
| InChI | InChI=1S/C29H35N4O2P/c1-6-32-27-12-8-7-11-24(27)25-20-23(15-16-28(25)32)36(29(3,4)5,31-17-9-10-18-31)30-26-19-22(33(34)35)14-13-21(26)2/h7-8,11-16,19-20H,6,9-10,17-18H2,1-5H3 |
| InChIKey | YCARKFGAFUHJAO-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 63.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|