C29H36N3P — CID 40929857
tert-butyl-(9-ethylcarbazol-3-yl)-(4-methylphenyl)imino-pyrrolidin-1-yl-λ5-phosphane (PubChem CID 40929857) has the molecular formula C29H36N3P and a molecular weight of 457.60 g/mol. Its IUPAC name is tert-butyl-(9-ethylcarbazol-3-yl)-(4-methylphenyl)imino-pyrrolidin-1-yl-λ5-phosphane.
| Compound Name | tert-butyl-(9-ethylcarbazol-3-yl)-(4-methylphenyl)imino-pyrrolidin-1-yl-λ5-phosphane |
|---|---|
| PubChem CID | 40929857 |
| Molecular Formula | C29H36N3P |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | tert-butyl-(9-ethylcarbazol-3-yl)-(4-methylphenyl)imino-pyrrolidin-1-yl-λ5-phosphane |
| SMILES | CCn1c2ccccc2c2cc([P@@](=Nc3ccc(C)cc3)(N3CCCC3)C(C)(C)C)ccc21 |
| InChI | InChI=1S/C29H36N3P/c1-6-32-27-12-8-7-11-25(27)26-21-24(17-18-28(26)32)33(29(3,4)5,31-19-9-10-20-31)30-23-15-13-22(2)14-16-23/h7-8,11-18,21H,6,9-10,19-20H2,1-5H3/t33-/m1/s1 |
| InChIKey | UFRONSXNRXRQQO-MGBGTMOVSA-N |
| XLogP | 8.09 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|