C14H12N4O4 — CID 25336221
(2S)-2-methyl-6-[(3-nitro-2-pyridinyl)amino]-4H-1,4-benzoxazin-3-one (PubChem CID 25336221) has the molecular formula C14H12N4O4 and a molecular weight of 300.27 g/mol. Its IUPAC name is (2S)-2-methyl-6-[(3-nitro-2-pyridinyl)amino]-4H-1,4-benzoxazin-3-one.
| Compound Name | (2S)-2-methyl-6-[(3-nitro-2-pyridinyl)amino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 25336221 |
| Molecular Formula | C14H12N4O4 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | (2S)-2-methyl-6-[(3-nitro-2-pyridinyl)amino]-4H-1,4-benzoxazin-3-one |
| SMILES | C[C@@H]1Oc2ccc(Nc3ncccc3[N+](=O)[O-])cc2NC1=O |
| InChI | InChI=1S/C14H12N4O4/c1-8-14(19)17-10-7-9(4-5-12(10)22-8)16-13-11(18(20)21)3-2-6-15-13/h2-8H,1H3,(H,15,16)(H,17,19)/t8-/m0/s1 |
| InChIKey | PHKYVLSXJHJPHH-QMMMGPOBSA-N |
| XLogP | 2.45 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|