C23H24ClF3N4O4 — CID 2534435
2-[4-[2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]piperazin-1-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 2534435) has the molecular formula C23H24ClF3N4O4 and a molecular weight of 512.92 g/mol. Its IUPAC name is 2-[4-[2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]piperazin-1-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-[2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]piperazin-1-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 2534435 |
| Molecular Formula | C23H24ClF3N4O4 |
| Molecular Weight | 512.92 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | 2-[4-[2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetyl]piperazin-1-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)CN2C(=O)[C@H]3CC=CC[C@H]3C2=O)CC1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H24ClF3N4O4/c24-18-6-5-14(11-17(18)23(25,26)27)28-19(32)12-29-7-9-30(10-8-29)20(33)13-31-21(34)15-3-1-2-4-16(15)22(31)35/h1-2,5-6,11,15-16H,3-4,7-10,12-13H2,(H,28,32)/t15-,16+ |
| InChIKey | SERKJRBCXVADCI-IYBDPMFKSA-N |
| XLogP | 2.39 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.92 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|