C18H21F2N3O4S — CID 25346203
2-(difluoromethoxy)-N-[5-(dimethylsulfamoyl)-2-(ethylamino)phenyl]benzamide (PubChem CID 25346203) has the molecular formula C18H21F2N3O4S and a molecular weight of 413.45 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-[5-(dimethylsulfamoyl)-2-(ethylamino)phenyl]benzamide.
| Compound Name | 2-(difluoromethoxy)-N-[5-(dimethylsulfamoyl)-2-(ethylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 25346203 |
| Molecular Formula | C18H21F2N3O4S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-(difluoromethoxy)-N-[5-(dimethylsulfamoyl)-2-(ethylamino)phenyl]benzamide |
| SMILES | CCNc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C18H21F2N3O4S/c1-4-21-14-10-9-12(28(25,26)23(2)3)11-15(14)22-17(24)13-7-5-6-8-16(13)27-18(19)20/h5-11,18,21H,4H2,1-3H3,(H,22,24) |
| InChIKey | XTBZJXFMWPCBOC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |