C24H25F3N4O3S — CID 25349770
N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-[5-nitro-1-[3-(trifluoromethyl)phenyl]benzimidazol-2-yl]sulfanylacetamide (PubChem CID 25349770) has the molecular formula C24H25F3N4O3S and a molecular weight of 506.55 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-[5-nitro-1-[3-(trifluoromethyl)phenyl]benzimidazol-2-yl]sulfanylacetamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-[5-nitro-1-[3-(trifluoromethyl)phenyl]benzimidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 25349770 |
| Molecular Formula | C24H25F3N4O3S |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-[5-nitro-1-[3-(trifluoromethyl)phenyl]benzimidazol-2-yl]sulfanylacetamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=O)CSc1nc2cc([N+](=O)[O-])ccc2n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H25F3N4O3S/c1-14-5-3-8-19(15(14)2)28-22(32)13-35-23-29-20-12-18(31(33)34)9-10-21(20)30(23)17-7-4-6-16(11-17)24(25,26)27/h4,6-7,9-12,14-15,19H,3,5,8,13H2,1-2H3,(H,28,32)/t14-,15-,19-/m1/s1 |
| InChIKey | FZXVXSHYLHIXTC-SPYBWZPUSA-N |
| XLogP | 5.99 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|