C26H26N4O2 — CID 25360515
N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-4-[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 25360515) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-4-[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-4-[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 25360515 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-4-[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | Cc1ccccc1-c1nnc(-c2ccc(C(=O)N(C)Cc3ccc(N(C)C)cc3)cc2)o1 |
| InChI | InChI=1S/C26H26N4O2/c1-18-7-5-6-8-23(18)25-28-27-24(32-25)20-11-13-21(14-12-20)26(31)30(4)17-19-9-15-22(16-10-19)29(2)3/h5-16H,17H2,1-4H3 |
| InChIKey | WPQMJXZUHNULDS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|