C21H23BrFN4OS+ — CID 2536216
3-[2-(4-bromophenoxy)ethylsulfanyl]-4-(4-fluorophenyl)-5-(pyrrolidin-1-ium-1-ylmethyl)-1,2,4-triazole (PubChem CID 2536216) has the molecular formula C21H23BrFN4OS+ and a molecular weight of 478.41 g/mol. Its IUPAC name is 3-[2-(4-bromophenoxy)ethylsulfanyl]-4-(4-fluorophenyl)-5-(pyrrolidin-1-ium-1-ylmethyl)-1,2,4-triazole.
| Compound Name | 3-[2-(4-bromophenoxy)ethylsulfanyl]-4-(4-fluorophenyl)-5-(pyrrolidin-1-ium-1-ylmethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 2536216 |
| Molecular Formula | C21H23BrFN4OS+ |
| Molecular Weight | 478.41 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 3-[2-(4-bromophenoxy)ethylsulfanyl]-4-(4-fluorophenyl)-5-(pyrrolidin-1-ium-1-ylmethyl)-1,2,4-triazole |
| SMILES | Fc1ccc(-n2c(C[NH+]3CCCC3)nnc2SCCOc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C21H22BrFN4OS/c22-16-3-9-19(10-4-16)28-13-14-29-21-25-24-20(15-26-11-1-2-12-26)27(21)18-7-5-17(23)6-8-18/h3-10H,1-2,11-15H2/p+1 |
| InChIKey | YBQBUTKRYDXIDW-UHFFFAOYSA-O |
| XLogP | 3.52 |
| TPSA | 44.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|