C20H14BrFN2O2S2 — CID 53366429
3-(4-bromophenyl)-2-[2-(4-fluorophenoxy)ethylsulfanyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 53366429) has the molecular formula C20H14BrFN2O2S2 and a molecular weight of 477.38 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2-[2-(4-fluorophenoxy)ethylsulfanyl]thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-(4-bromophenyl)-2-[2-(4-fluorophenoxy)ethylsulfanyl]thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 53366429 |
| Molecular Formula | C20H14BrFN2O2S2 |
| Molecular Weight | 477.38 g/mol |
| Exact Mass | 475.97 |
| IUPAC Name | 3-(4-bromophenyl)-2-[2-(4-fluorophenoxy)ethylsulfanyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2sccc2nc(SCCOc2ccc(F)cc2)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H14BrFN2O2S2/c21-13-1-5-15(6-2-13)24-19(25)18-17(9-11-27-18)23-20(24)28-12-10-26-16-7-3-14(22)4-8-16/h1-9,11H,10,12H2 |
| InChIKey | CSDSMJMCSDNALK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.38 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|