C25H18Cl2N2O5 — CID 2536311
[4-[(2R)-3-(2,4-dichloroanilino)-2-(1,3-dioxoisoindol-2-yl)-3-oxopropyl]phenyl] acetate (PubChem CID 2536311) has the molecular formula C25H18Cl2N2O5 and a molecular weight of 497.33 g/mol. Its IUPAC name is [4-[(2R)-3-(2,4-dichloroanilino)-2-(1,3-dioxoisoindol-2-yl)-3-oxopropyl]phenyl] acetate.
| Compound Name | [4-[(2R)-3-(2,4-dichloroanilino)-2-(1,3-dioxoisoindol-2-yl)-3-oxopropyl]phenyl] acetate |
|---|---|
| PubChem CID | 2536311 |
| Molecular Formula | C25H18Cl2N2O5 |
| Molecular Weight | 497.33 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | [4-[(2R)-3-(2,4-dichloroanilino)-2-(1,3-dioxoisoindol-2-yl)-3-oxopropyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C[C@H](C(=O)Nc2ccc(Cl)cc2Cl)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C25H18Cl2N2O5/c1-14(30)34-17-9-6-15(7-10-17)12-22(23(31)28-21-11-8-16(26)13-20(21)27)29-24(32)18-4-2-3-5-19(18)25(29)33/h2-11,13,22H,12H2,1H3,(H,28,31)/t22-/m1/s1 |
| InChIKey | PCUHNIMCUBHVDB-JOCHJYFZSA-N |
| XLogP | 4.76 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|