C27H20N2O5 — CID 43043273
[4-[2-(1,3-dioxoisoindol-2-yl)-3-(3-ethynylanilino)-3-oxopropyl]phenyl] acetate (PubChem CID 43043273) has the molecular formula C27H20N2O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is [4-[2-(1,3-dioxoisoindol-2-yl)-3-(3-ethynylanilino)-3-oxopropyl]phenyl] acetate.
| Compound Name | [4-[2-(1,3-dioxoisoindol-2-yl)-3-(3-ethynylanilino)-3-oxopropyl]phenyl] acetate |
|---|---|
| PubChem CID | 43043273 |
| Molecular Formula | C27H20N2O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | [4-[2-(1,3-dioxoisoindol-2-yl)-3-(3-ethynylanilino)-3-oxopropyl]phenyl] acetate |
| SMILES | C#Cc1cccc(NC(=O)C(Cc2ccc(OC(C)=O)cc2)N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C27H20N2O5/c1-3-18-7-6-8-20(15-18)28-25(31)24(16-19-11-13-21(14-12-19)34-17(2)30)29-26(32)22-9-4-5-10-23(22)27(29)33/h1,4-15,24H,16H2,2H3,(H,28,31) |
| InChIKey | IZJXBKHHJWLZOT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|