C19H24FNO3 — CID 25365354
ethyl (3R)-1-but-3-enoyl-3-[(2-fluorophenyl)methyl]piperidine-3-carboxylate (PubChem CID 25365354) has the molecular formula C19H24FNO3 and a molecular weight of 333.40 g/mol. Its IUPAC name is ethyl (3R)-1-but-3-enoyl-3-[(2-fluorophenyl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-but-3-enoyl-3-[(2-fluorophenyl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 25365354 |
| Molecular Formula | C19H24FNO3 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | ethyl (3R)-1-but-3-enoyl-3-[(2-fluorophenyl)methyl]piperidine-3-carboxylate |
| SMILES | C=CCC(=O)N1CCC[C@](Cc2ccccc2F)(C(=O)OCC)C1 |
| InChI | InChI=1S/C19H24FNO3/c1-3-8-17(22)21-12-7-11-19(14-21,18(23)24-4-2)13-15-9-5-6-10-16(15)20/h3,5-6,9-10H,1,4,7-8,11-14H2,2H3/t19-/m1/s1 |
| InChIKey | AYFXEMZABWYIKI-LJQANCHMSA-N |
| XLogP | 3.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|