C20H24FN3O3 — CID 42095294
ethyl (3S)-3-[(2-fluorophenyl)methyl]-1-(2-imidazol-1-ylacetyl)piperidine-3-carboxylate (PubChem CID 42095294) has the molecular formula C20H24FN3O3 and a molecular weight of 373.43 g/mol. Its IUPAC name is ethyl (3S)-3-[(2-fluorophenyl)methyl]-1-(2-imidazol-1-ylacetyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-3-[(2-fluorophenyl)methyl]-1-(2-imidazol-1-ylacetyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 42095294 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | ethyl (3S)-3-[(2-fluorophenyl)methyl]-1-(2-imidazol-1-ylacetyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(Cc2ccccc2F)CCCN(C(=O)Cn2ccnc2)C1 |
| InChI | InChI=1S/C20H24FN3O3/c1-2-27-19(26)20(12-16-6-3-4-7-17(16)21)8-5-10-24(14-20)18(25)13-23-11-9-22-15-23/h3-4,6-7,9,11,15H,2,5,8,10,12-14H2,1H3/t20-/m0/s1 |
| InChIKey | HNAKGSHEJZRYEM-FQEVSTJZSA-N |
| XLogP | 2.44 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |