C19H26FNO4 — CID 42346729
ethyl (3S)-3-[(2-fluorophenyl)methyl]-1-(3-methoxypropanoyl)piperidine-3-carboxylate (PubChem CID 42346729) has the molecular formula C19H26FNO4 and a molecular weight of 351.42 g/mol. Its IUPAC name is ethyl (3S)-3-[(2-fluorophenyl)methyl]-1-(3-methoxypropanoyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-3-[(2-fluorophenyl)methyl]-1-(3-methoxypropanoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 42346729 |
| Molecular Formula | C19H26FNO4 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | ethyl (3S)-3-[(2-fluorophenyl)methyl]-1-(3-methoxypropanoyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(Cc2ccccc2F)CCCN(C(=O)CCOC)C1 |
| InChI | InChI=1S/C19H26FNO4/c1-3-25-18(23)19(13-15-7-4-5-8-16(15)20)10-6-11-21(14-19)17(22)9-12-24-2/h4-5,7-8H,3,6,9-14H2,1-2H3/t19-/m0/s1 |
| InChIKey | JWDVUWMGVMLTRO-IBGZPJMESA-N |
| XLogP | 2.58 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |