C14H22N4OS2 — CID 25376882
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide (PubChem CID 25376882) has the molecular formula C14H22N4OS2 and a molecular weight of 326.49 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
|---|---|
| PubChem CID | 25376882 |
| Molecular Formula | C14H22N4OS2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](NC(=O)CSc1nnc(N)s1)C2 |
| InChI | InChI=1S/C14H22N4OS2/c1-13(2)8-4-5-14(13,3)9(6-8)16-10(19)7-20-12-18-17-11(15)21-12/h8-9H,4-7H2,1-3H3,(H2,15,17)(H,16,19)/t8-,9+,14+/m1/s1 |
| InChIKey | CXGBYDSCKMTXMW-ITMYJUKJSA-N |
| XLogP | 2.54 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |