C23H33FN2O — CID 25384161
2-(cyclohexen-1-yl)-N-[[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]methyl]-N-methylacetamide (PubChem CID 25384161) has the molecular formula C23H33FN2O and a molecular weight of 372.53 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-[[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]methyl]-N-methylacetamide.
| Compound Name | 2-(cyclohexen-1-yl)-N-[[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 25384161 |
| Molecular Formula | C23H33FN2O |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-[[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]methyl]-N-methylacetamide |
| SMILES | CN(CC1CCN(CCc2ccc(F)cc2)CC1)C(=O)CC1=CCCCC1 |
| InChI | InChI=1S/C23H33FN2O/c1-25(23(27)17-20-5-3-2-4-6-20)18-21-12-15-26(16-13-21)14-11-19-7-9-22(24)10-8-19/h5,7-10,21H,2-4,6,11-18H2,1H3 |
| InChIKey | DLRXCPZKKIXNJO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|