About 5,6-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine
5,6-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 25384792) has the molecular formula C19H18N4S2
and a molecular weight of 366.52 g/mol. Its IUPAC name is 5,6-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5,6-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 25384792 |
| Molecular Formula | C19H18N4S2 |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 5,6-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1sc2nc(-c3cccs3)nc(N[C@H](C)c3ccccn3)c2c1C |
| InChI | InChI=1S/C19H18N4S2/c1-11-13(3)25-19-16(11)18(21-12(2)14-7-4-5-9-20-14)22-17(23-19)15-8-6-10-24-15/h4-10,12H,1-3H3,(H,21,22,23)/t12-/m1/s1 |
| InChIKey | RYOOKTRLUJMBTO-GFCCVEGCSA-N |
| XLogP | 5.60 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5,6-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 5,6-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine (CID 25384792) is 5,6-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 5,6-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 5,6-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine is Cc1sc2nc(-c3cccs3)nc(N[C@H](C)c3ccccn3)c2c1C.
What is the InChIKey of 5,6-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine?
The InChIKey is RYOOKTRLUJMBTO-GFCCVEGCSA-N. The full InChI is InChI=1S/C19H18N4S2/c1-11-13(3)25-19-16(11)18(21-12(2)14-7-4-5-9-20-14)22-17(23-19)15-8-6-10-24-15/h4-10,12H,1-3H3,(H,21,22,23)/t12-/m1/s1.
What are the key properties of 5,6-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine?
5,6-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine has a molecular weight of 366.52 g/mol, XLogP of 5.60, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 25384792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).