C16H18N4OS2 — CID 18081556
N-[2-[(5,6-dimethyl-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]acetamide (PubChem CID 18081556) has the molecular formula C16H18N4OS2 and a molecular weight of 346.48 g/mol. Its IUPAC name is N-[2-[(5,6-dimethyl-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]acetamide.
| Compound Name | N-[2-[(5,6-dimethyl-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 18081556 |
| Molecular Formula | C16H18N4OS2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-[2-[(5,6-dimethyl-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1nc(-c2cccs2)nc2sc(C)c(C)c12 |
| InChI | InChI=1S/C16H18N4OS2/c1-9-10(2)23-16-13(9)15(18-7-6-17-11(3)21)19-14(20-16)12-5-4-8-22-12/h4-5,8H,6-7H2,1-3H3,(H,17,21)(H,18,19,20) |
| InChIKey | DTJOVMINSWWNRS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|