C19H18ClNO6 — CID 2539752
[2-(3-chloroanilino)-2-oxoethyl] 2-(4-acetyl-2-methoxyphenoxy)acetate (PubChem CID 2539752) has the molecular formula C19H18ClNO6 and a molecular weight of 391.81 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] 2-(4-acetyl-2-methoxyphenoxy)acetate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] 2-(4-acetyl-2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 2539752 |
| Molecular Formula | C19H18ClNO6 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] 2-(4-acetyl-2-methoxyphenoxy)acetate |
| SMILES | COc1cc(C(C)=O)ccc1OCC(=O)OCC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H18ClNO6/c1-12(22)13-6-7-16(17(8-13)25-2)26-11-19(24)27-10-18(23)21-15-5-3-4-14(20)9-15/h3-9H,10-11H2,1-2H3,(H,21,23) |
| InChIKey | DFMNKPYUEAAHLR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |