C22H29N3O4S — CID 25409070
N-[4-[(2R)-butan-2-yl]phenyl]-2-[5-(cyclopropylsulfamoyl)-2-methoxyanilino]acetamide (PubChem CID 25409070) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is N-[4-[(2R)-butan-2-yl]phenyl]-2-[5-(cyclopropylsulfamoyl)-2-methoxyanilino]acetamide.
| Compound Name | N-[4-[(2R)-butan-2-yl]phenyl]-2-[5-(cyclopropylsulfamoyl)-2-methoxyanilino]acetamide |
|---|---|
| PubChem CID | 25409070 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N-[4-[(2R)-butan-2-yl]phenyl]-2-[5-(cyclopropylsulfamoyl)-2-methoxyanilino]acetamide |
| SMILES | CC[C@@H](C)c1ccc(NC(=O)CNc2cc(S(=O)(=O)NC3CC3)ccc2OC)cc1 |
| InChI | InChI=1S/C22H29N3O4S/c1-4-15(2)16-5-7-17(8-6-16)24-22(26)14-23-20-13-19(11-12-21(20)29-3)30(27,28)25-18-9-10-18/h5-8,11-13,15,18,23,25H,4,9-10,14H2,1-3H3,(H,24,26)/t15-/m1/s1 |
| InChIKey | PKHGPWZGOXLKEA-OAHLLOKOSA-N |
| XLogP | 3.70 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |