C20H23N3O6S — CID 37174802
methyl 2-[[2-[5-(cyclopropylsulfamoyl)-2-methoxyanilino]acetyl]amino]benzoate (PubChem CID 37174802) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is methyl 2-[[2-[5-(cyclopropylsulfamoyl)-2-methoxyanilino]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[5-(cyclopropylsulfamoyl)-2-methoxyanilino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 37174802 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | methyl 2-[[2-[5-(cyclopropylsulfamoyl)-2-methoxyanilino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CNc1cc(S(=O)(=O)NC2CC2)ccc1OC |
| InChI | InChI=1S/C20H23N3O6S/c1-28-18-10-9-14(30(26,27)23-13-7-8-13)11-17(18)21-12-19(24)22-16-6-4-3-5-15(16)20(25)29-2/h3-6,9-11,13,21,23H,7-8,12H2,1-2H3,(H,22,24) |
| InChIKey | PQVHFUIPNOXDDE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |