C19H21F2N3O5S — CID 37174879
2-[5-(cyclopropylsulfamoyl)-2-methoxyanilino]-N-[4-(difluoromethoxy)phenyl]acetamide (PubChem CID 37174879) has the molecular formula C19H21F2N3O5S and a molecular weight of 441.46 g/mol. Its IUPAC name is 2-[5-(cyclopropylsulfamoyl)-2-methoxyanilino]-N-[4-(difluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[5-(cyclopropylsulfamoyl)-2-methoxyanilino]-N-[4-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 37174879 |
| Molecular Formula | C19H21F2N3O5S |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 2-[5-(cyclopropylsulfamoyl)-2-methoxyanilino]-N-[4-(difluoromethoxy)phenyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CC2)cc1NCC(=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H21F2N3O5S/c1-28-17-9-8-15(30(26,27)24-13-2-3-13)10-16(17)22-11-18(25)23-12-4-6-14(7-5-12)29-19(20)21/h4-10,13,19,22,24H,2-3,11H2,1H3,(H,23,25) |
| InChIKey | DJGULUOOSGDDIN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |