C16H18ClN3OS — CID 25416730
(2R)-N-[(4-chlorophenyl)methyl]-2-(1-cyclopropylimidazol-2-yl)sulfanylpropanamide (PubChem CID 25416730) has the molecular formula C16H18ClN3OS and a molecular weight of 335.86 g/mol. Its IUPAC name is (2R)-N-[(4-chlorophenyl)methyl]-2-(1-cyclopropylimidazol-2-yl)sulfanylpropanamide.
| Compound Name | (2R)-N-[(4-chlorophenyl)methyl]-2-(1-cyclopropylimidazol-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 25416730 |
| Molecular Formula | C16H18ClN3OS |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | (2R)-N-[(4-chlorophenyl)methyl]-2-(1-cyclopropylimidazol-2-yl)sulfanylpropanamide |
| SMILES | C[C@@H](Sc1nccn1C1CC1)C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H18ClN3OS/c1-11(22-16-18-8-9-20(16)14-6-7-14)15(21)19-10-12-2-4-13(17)5-3-12/h2-5,8-9,11,14H,6-7,10H2,1H3,(H,19,21)/t11-/m1/s1 |
| InChIKey | WQERELSAFDKPGZ-LLVKDONJSA-N |
| XLogP | 3.67 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |