C19H23Cl2N3O3S — CID 25418065
3-[[(2R)-butan-2-yl]amino]-N-[4-chloro-3-[(4-chlorophenyl)sulfamoyl]phenyl]propanamide (PubChem CID 25418065) has the molecular formula C19H23Cl2N3O3S and a molecular weight of 444.38 g/mol. Its IUPAC name is 3-[[(2R)-butan-2-yl]amino]-N-[4-chloro-3-[(4-chlorophenyl)sulfamoyl]phenyl]propanamide.
| Compound Name | 3-[[(2R)-butan-2-yl]amino]-N-[4-chloro-3-[(4-chlorophenyl)sulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 25418065 |
| Molecular Formula | C19H23Cl2N3O3S |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 3-[[(2R)-butan-2-yl]amino]-N-[4-chloro-3-[(4-chlorophenyl)sulfamoyl]phenyl]propanamide |
| SMILES | CC[C@@H](C)NCCC(=O)Nc1ccc(Cl)c(S(=O)(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H23Cl2N3O3S/c1-3-13(2)22-11-10-19(25)23-16-8-9-17(21)18(12-16)28(26,27)24-15-6-4-14(20)5-7-15/h4-9,12-13,22,24H,3,10-11H2,1-2H3,(H,23,25)/t13-/m1/s1 |
| InChIKey | NBRNEBZSLMEYFA-CYBMUJFWSA-N |
| XLogP | 4.51 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |