C19H19ClN2O3 — CID 25420567
2-[(3R)-4-benzyl-2-oxomorpholin-3-yl]-N-(3-chlorophenyl)acetamide (PubChem CID 25420567) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is 2-[(3R)-4-benzyl-2-oxomorpholin-3-yl]-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-[(3R)-4-benzyl-2-oxomorpholin-3-yl]-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 25420567 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-[(3R)-4-benzyl-2-oxomorpholin-3-yl]-N-(3-chlorophenyl)acetamide |
| SMILES | O=C(C[C@@H]1C(=O)OCCN1Cc1ccccc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H19ClN2O3/c20-15-7-4-8-16(11-15)21-18(23)12-17-19(24)25-10-9-22(17)13-14-5-2-1-3-6-14/h1-8,11,17H,9-10,12-13H2,(H,21,23)/t17-/m1/s1 |
| InChIKey | NSHVXXAPIQADHQ-QGZVFWFLSA-N |
| XLogP | 3.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |