C19H18Cl2N2O3 — CID 41475117
2-[(3R)-4-benzyl-2-oxomorpholin-3-yl]-N-(3,4-dichlorophenyl)acetamide (PubChem CID 41475117) has the molecular formula C19H18Cl2N2O3 and a molecular weight of 393.27 g/mol. Its IUPAC name is 2-[(3R)-4-benzyl-2-oxomorpholin-3-yl]-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-[(3R)-4-benzyl-2-oxomorpholin-3-yl]-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 41475117 |
| Molecular Formula | C19H18Cl2N2O3 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 2-[(3R)-4-benzyl-2-oxomorpholin-3-yl]-N-(3,4-dichlorophenyl)acetamide |
| SMILES | O=C(C[C@@H]1C(=O)OCCN1Cc1ccccc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H18Cl2N2O3/c20-15-7-6-14(10-16(15)21)22-18(24)11-17-19(25)26-9-8-23(17)12-13-4-2-1-3-5-13/h1-7,10,17H,8-9,11-12H2,(H,22,24)/t17-/m1/s1 |
| InChIKey | OBDCPWFMKYIRKF-QGZVFWFLSA-N |
| XLogP | 3.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |