C25H24N2O4 — CID 41281603
2-[(3R)-4-benzyl-2-oxomorpholin-3-yl]-N-(4-phenoxyphenyl)acetamide (PubChem CID 41281603) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-[(3R)-4-benzyl-2-oxomorpholin-3-yl]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[(3R)-4-benzyl-2-oxomorpholin-3-yl]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 41281603 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 2-[(3R)-4-benzyl-2-oxomorpholin-3-yl]-N-(4-phenoxyphenyl)acetamide |
| SMILES | O=C(C[C@@H]1C(=O)OCCN1Cc1ccccc1)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N2O4/c28-24(26-20-11-13-22(14-12-20)31-21-9-5-2-6-10-21)17-23-25(29)30-16-15-27(23)18-19-7-3-1-4-8-19/h1-14,23H,15-18H2,(H,26,28)/t23-/m1/s1 |
| InChIKey | XVHJRIVNWBFMQW-HSZRJFAPSA-N |
| XLogP | 4.24 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |