C16H11NO4-2 — CID 25421122
(E,4E)-3-methyl-4-(quinolin-2-ylmethylidene)pent-2-enedioate (PubChem CID 25421122) has the molecular formula C16H11NO4-2 and a molecular weight of 281.27 g/mol. Its IUPAC name is (E,4E)-3-methyl-4-(quinolin-2-ylmethylidene)pent-2-enedioate.
| Compound Name | (E,4E)-3-methyl-4-(quinolin-2-ylmethylidene)pent-2-enedioate |
|---|---|
| PubChem CID | 25421122 |
| Molecular Formula | C16H11NO4-2 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | (E,4E)-3-methyl-4-(quinolin-2-ylmethylidene)pent-2-enedioate |
| SMILES | CC(=C\C(=O)[O-])/C(=C\c1ccc2ccccc2n1)C(=O)[O-] |
| InChI | InChI=1S/C16H13NO4/c1-10(8-15(18)19)13(16(20)21)9-12-7-6-11-4-2-3-5-14(11)17-12/h2-9H,1H3,(H,18,19)(H,20,21)/p-2/b10-8+,13-9+ |
| InChIKey | KAUVQSBEHWWUGQ-IAQVKYGWSA-L |
| XLogP | 0.06 |
| TPSA | 93.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|